C16H13FIN5O4 — CID 163497589
6-cyano-2-(2-fluoro-4-iodoanilino)-N-[3-(hydroxyamino)-3-oxopropoxy]pyridine-3-carboxamide (PubChem CID 163497589) has the molecular formula C16H13FIN5O4 and a molecular weight of 485.21 g/mol. Its IUPAC name is 6-cyano-2-(2-fluoro-4-iodoanilino)-N-[3-(hydroxyamino)-3-oxopropoxy]pyridine-3-carboxamide.
| Compound Name | 6-cyano-2-(2-fluoro-4-iodoanilino)-N-[3-(hydroxyamino)-3-oxopropoxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 163497589 |
| Molecular Formula | C16H13FIN5O4 |
| Molecular Weight | 485.21 g/mol |
| Exact Mass | 485.00 |
| IUPAC Name | 6-cyano-2-(2-fluoro-4-iodoanilino)-N-[3-(hydroxyamino)-3-oxopropoxy]pyridine-3-carboxamide |
| SMILES | N#Cc1ccc(C(=O)NOCCC(=O)NO)c(Nc2ccc(I)cc2F)n1 |
| InChI | InChI=1S/C16H13FIN5O4/c17-12-7-9(18)1-4-13(12)21-15-11(3-2-10(8-19)20-15)16(25)23-27-6-5-14(24)22-26/h1-4,7,26H,5-6H2,(H,20,21)(H,22,24)(H,23,25) |
| InChIKey | CSAOREKIOMUXKE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 136.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.21 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|