C18H16FIN4O4 — CID 175167666
2-[[4-cyano-2-(2-fluoro-4-iodoanilino)benzoyl]amino]oxyethyl N-methylcarbamate (PubChem CID 175167666) has the molecular formula C18H16FIN4O4 and a molecular weight of 498.25 g/mol. Its IUPAC name is 2-[[4-cyano-2-(2-fluoro-4-iodoanilino)benzoyl]amino]oxyethyl N-methylcarbamate.
| Compound Name | 2-[[4-cyano-2-(2-fluoro-4-iodoanilino)benzoyl]amino]oxyethyl N-methylcarbamate |
|---|---|
| PubChem CID | 175167666 |
| Molecular Formula | C18H16FIN4O4 |
| Molecular Weight | 498.25 g/mol |
| Exact Mass | 498.02 |
| IUPAC Name | 2-[[4-cyano-2-(2-fluoro-4-iodoanilino)benzoyl]amino]oxyethyl N-methylcarbamate |
| SMILES | CNC(=O)OCCONC(=O)c1ccc(C#N)cc1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C18H16FIN4O4/c1-22-18(26)27-6-7-28-24-17(25)13-4-2-11(10-21)8-16(13)23-15-5-3-12(20)9-14(15)19/h2-5,8-9,23H,6-7H2,1H3,(H,22,26)(H,24,25) |
| InChIKey | ZVVULAUAILUDFG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.25 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|