C25H34F3N3O6 — CID 143173037
acetaldehyde;3,4-difluoro-2-(2-fluoro-4-methylanilino)-5-[[formyl(2-methoxyethyl)amino]methyl]-N-(2-hydroxyethoxy)benzamide;ethane (PubChem CID 143173037) has the molecular formula C25H34F3N3O6 and a molecular weight of 529.56 g/mol. Its IUPAC name is acetaldehyde;3,4-difluoro-2-(2-fluoro-4-methylanilino)-5-[[formyl(2-methoxyethyl)amino]methyl]-N-(2-hydroxyethoxy)benzamide;ethane.
| Compound Name | acetaldehyde;3,4-difluoro-2-(2-fluoro-4-methylanilino)-5-[[formyl(2-methoxyethyl)amino]methyl]-N-(2-hydroxyethoxy)benzamide;ethane |
|---|---|
| PubChem CID | 143173037 |
| Molecular Formula | C25H34F3N3O6 |
| Molecular Weight | 529.56 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | acetaldehyde;3,4-difluoro-2-(2-fluoro-4-methylanilino)-5-[[formyl(2-methoxyethyl)amino]methyl]-N-(2-hydroxyethoxy)benzamide;ethane |
| SMILES | CC.CC=O.COCCN(C=O)Cc1cc(C(=O)NOCCO)c(Nc2ccc(C)cc2F)c(F)c1F |
| InChI | InChI=1S/C21H24F3N3O5.C2H4O.C2H6/c1-13-3-4-17(16(22)9-13)25-20-15(21(30)26-32-8-6-28)10-14(18(23)19(20)24)11-27(12-29)5-7-31-2;1-2-3;1-2/h3-4,9-10,12,25,28H,5-8,11H2,1-2H3,(H,26,30);2H,1H3;1-2H3 |
| InChIKey | HGLJGJTVRHYSJS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.56 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|