C18H16F3IN2O5 — CID 156808726
methyl 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[[(2-hydroxyacetyl)-methoxyamino]methyl]benzoate (PubChem CID 156808726) has the molecular formula C18H16F3IN2O5 and a molecular weight of 524.23 g/mol. Its IUPAC name is methyl 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[[(2-hydroxyacetyl)-methoxyamino]methyl]benzoate.
| Compound Name | methyl 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[[(2-hydroxyacetyl)-methoxyamino]methyl]benzoate |
|---|---|
| PubChem CID | 156808726 |
| Molecular Formula | C18H16F3IN2O5 |
| Molecular Weight | 524.23 g/mol |
| Exact Mass | 524.01 |
| IUPAC Name | methyl 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[[(2-hydroxyacetyl)-methoxyamino]methyl]benzoate |
| SMILES | COC(=O)c1cc(CN(OC)C(=O)CO)c(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C18H16F3IN2O5/c1-28-18(27)11-5-9(7-24(29-2)14(26)8-25)15(20)16(21)17(11)23-13-4-3-10(22)6-12(13)19/h3-6,23,25H,7-8H2,1-2H3 |
| InChIKey | RJNVMJYIQORVAO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.23 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|