C24H28F4N6O2S2 — CID 166677316
3,4-difluoro-2-(2-fluoro-4-methylanilino)-5-[[3-fluoro-2-[[methyl(propylamino)amino]sulfanyloxyamino]-4-pyridinyl]methyl]benzamide;sulfane (PubChem CID 166677316) has the molecular formula C24H28F4N6O2S2 and a molecular weight of 572.65 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-methylanilino)-5-[[3-fluoro-2-[[methyl(propylamino)amino]sulfanyloxyamino]-4-pyridinyl]methyl]benzamide;sulfane.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-methylanilino)-5-[[3-fluoro-2-[[methyl(propylamino)amino]sulfanyloxyamino]-4-pyridinyl]methyl]benzamide;sulfane |
|---|---|
| PubChem CID | 166677316 |
| Molecular Formula | C24H28F4N6O2S2 |
| Molecular Weight | 572.65 g/mol |
| Exact Mass | 572.17 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-methylanilino)-5-[[3-fluoro-2-[[methyl(propylamino)amino]sulfanyloxyamino]-4-pyridinyl]methyl]benzamide;sulfane |
| SMILES | CCCNN(C)SONc1nccc(Cc2cc(C(N)=O)c(Nc3ccc(C)cc3F)c(F)c2F)c1F.S |
| InChI | InChI=1S/C24H26F4N6O2S.H2S/c1-4-8-31-34(3)37-36-33-24-20(27)14(7-9-30-24)11-15-12-16(23(29)35)22(21(28)19(15)26)32-18-6-5-13(2)10-17(18)25;/h5-7,9-10,12,31-32H,4,8,11H2,1-3H3,(H2,29,35)(H,30,33);1H2 |
| InChIKey | GJZVLMWREXRPCQ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.65 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|