C14H11ClF2N2O2 — CID 89277151
5-chloro-2-[(3,5-dimethyl-2-pyridinyl)amino]-3,4-difluorobenzoic acid (PubChem CID 89277151) has the molecular formula C14H11ClF2N2O2 and a molecular weight of 312.70 g/mol. Its IUPAC name is 5-chloro-2-[(3,5-dimethyl-2-pyridinyl)amino]-3,4-difluorobenzoic acid.
| Compound Name | 5-chloro-2-[(3,5-dimethyl-2-pyridinyl)amino]-3,4-difluorobenzoic acid |
|---|---|
| PubChem CID | 89277151 |
| Molecular Formula | C14H11ClF2N2O2 |
| Molecular Weight | 312.70 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 5-chloro-2-[(3,5-dimethyl-2-pyridinyl)amino]-3,4-difluorobenzoic acid |
| SMILES | Cc1cnc(Nc2c(C(=O)O)cc(Cl)c(F)c2F)c(C)c1 |
| InChI | InChI=1S/C14H11ClF2N2O2/c1-6-3-7(2)13(18-5-6)19-12-8(14(20)21)4-9(15)10(16)11(12)17/h3-5H,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | ZCCLSFPKPDOVRY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.70 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|