C14H11BBrF2N3O2 — CID 89277166
CID 89277166 (PubChem CID 89277166) has the molecular formula C14H11BBrF2N3O2 and a molecular weight of 381.97 g/mol.
| Compound Name | CID 89277166 |
|---|---|
| PubChem CID | 89277166 |
| Molecular Formula | C14H11BBrF2N3O2 |
| Molecular Weight | 381.97 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(Nc2c(C(=O)NOC)cc(Br)c(F)c2F)c(C)c1 |
| InChI | InChI=1S/C14H11BBrF2N3O2/c1-6-3-7(15)5-19-13(6)20-12-8(14(22)21-23-2)4-9(16)10(17)11(12)18/h3-5H,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | PDWNUUINPYZNCV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.97 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|