C16H11Cl2F3N2O3 — CID 152542515
2-[2-chloro-5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]phenyl]-N-ethoxy-2-oxoacetamide (PubChem CID 152542515) has the molecular formula C16H11Cl2F3N2O3 and a molecular weight of 407.18 g/mol. Its IUPAC name is 2-[2-chloro-5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]phenyl]-N-ethoxy-2-oxoacetamide.
| Compound Name | 2-[2-chloro-5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]phenyl]-N-ethoxy-2-oxoacetamide |
|---|---|
| PubChem CID | 152542515 |
| Molecular Formula | C16H11Cl2F3N2O3 |
| Molecular Weight | 407.18 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | 2-[2-chloro-5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]phenyl]-N-ethoxy-2-oxoacetamide |
| SMILES | CCONC(=O)C(=O)c1cc(-c2ncc(C(F)(F)F)cc2Cl)ccc1Cl |
| InChI | InChI=1S/C16H11Cl2F3N2O3/c1-2-26-23-15(25)14(24)10-5-8(3-4-11(10)17)13-12(18)6-9(7-22-13)16(19,20)21/h3-7H,2H2,1H3,(H,23,25) |
| InChIKey | YLVFEXRWYDCAPV-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.18 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|