C15H11Cl2F3N2O4S — CID 67658414
[[2-chloro-5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]phenyl]sulfonylamino] propanoate (PubChem CID 67658414) has the molecular formula C15H11Cl2F3N2O4S and a molecular weight of 443.23 g/mol. Its IUPAC name is [[2-chloro-5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]phenyl]sulfonylamino] propanoate.
| Compound Name | [[2-chloro-5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]phenyl]sulfonylamino] propanoate |
|---|---|
| PubChem CID | 67658414 |
| Molecular Formula | C15H11Cl2F3N2O4S |
| Molecular Weight | 443.23 g/mol |
| Exact Mass | 441.98 |
| IUPAC Name | [[2-chloro-5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]phenyl]sulfonylamino] propanoate |
| SMILES | CCC(=O)ONS(=O)(=O)c1cc(-c2ncc(C(F)(F)F)cc2Cl)ccc1Cl |
| InChI | InChI=1S/C15H11Cl2F3N2O4S/c1-2-13(23)26-22-27(24,25)12-5-8(3-4-10(12)16)14-11(17)6-9(7-21-14)15(18,19)20/h3-7,22H,2H2,1H3 |
| InChIKey | NCVZZTUQZSQNAB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.23 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|