C13H12ClF3N3O3S+ — CID 166830036
methyl 2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyridazin-1-ium-1-yl]ethanesulfonate (PubChem CID 166830036) has the molecular formula C13H12ClF3N3O3S+ and a molecular weight of 382.77 g/mol. Its IUPAC name is methyl 2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyridazin-1-ium-1-yl]ethanesulfonate.
| Compound Name | methyl 2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyridazin-1-ium-1-yl]ethanesulfonate |
|---|---|
| PubChem CID | 166830036 |
| Molecular Formula | C13H12ClF3N3O3S+ |
| Molecular Weight | 382.77 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | methyl 2-[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]pyridazin-1-ium-1-yl]ethanesulfonate |
| SMILES | COS(=O)(=O)CC[n+]1ccc(-c2ncc(C(F)(F)F)cc2Cl)cn1 |
| InChI | InChI=1S/C13H12ClF3N3O3S/c1-23-24(21,22)5-4-20-3-2-9(7-19-20)12-11(14)6-10(8-18-12)13(15,16)17/h2-3,6-8H,4-5H2,1H3/q+1 |
| InChIKey | YRKZODJNXGTYCP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 73.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.77 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|