C14H8ClF6NO — CID 142577160
3-chloro-2-[3-methyl-5-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)pyridine (PubChem CID 142577160) has the molecular formula C14H8ClF6NO and a molecular weight of 355.67 g/mol. Its IUPAC name is 3-chloro-2-[3-methyl-5-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)pyridine.
| Compound Name | 3-chloro-2-[3-methyl-5-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 142577160 |
| Molecular Formula | C14H8ClF6NO |
| Molecular Weight | 355.67 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 3-chloro-2-[3-methyl-5-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)pyridine |
| SMILES | Cc1cc(OC(F)(F)F)cc(-c2ncc(C(F)(F)F)cc2Cl)c1 |
| InChI | InChI=1S/C14H8ClF6NO/c1-7-2-8(4-10(3-7)23-14(19,20)21)12-11(15)5-9(6-22-12)13(16,17)18/h2-6H,1H3 |
| InChIKey | ZMMMHPUZGLAUOU-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.67 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |