C13H7ClF3N3O — CID 103595987
5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-1-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 103595987) has the molecular formula C13H7ClF3N3O and a molecular weight of 313.67 g/mol. Its IUPAC name is 5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-1-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-1-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 103595987 |
| Molecular Formula | C13H7ClF3N3O |
| Molecular Weight | 313.67 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-1-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | Cn1cc(-c2ncc(C(F)(F)F)cc2Cl)cc(C#N)c1=O |
| InChI | InChI=1S/C13H7ClF3N3O/c1-20-6-8(2-7(4-18)12(20)21)11-10(14)3-9(5-19-11)13(15,16)17/h2-3,5-6H,1H3 |
| InChIKey | PNENPPFCUMPSRW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.67 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |