C17H17ClF3N5O4S2 — CID 150719647
N'-[5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-cyanophenyl]-N'-(ethylsulfonylamino)ethanesulfonohydrazide (PubChem CID 150719647) has the molecular formula C17H17ClF3N5O4S2 and a molecular weight of 511.94 g/mol. Its IUPAC name is N'-[5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-cyanophenyl]-N'-(ethylsulfonylamino)ethanesulfonohydrazide.
| Compound Name | N'-[5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-cyanophenyl]-N'-(ethylsulfonylamino)ethanesulfonohydrazide |
|---|---|
| PubChem CID | 150719647 |
| Molecular Formula | C17H17ClF3N5O4S2 |
| Molecular Weight | 511.94 g/mol |
| Exact Mass | 511.04 |
| IUPAC Name | N'-[5-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-cyanophenyl]-N'-(ethylsulfonylamino)ethanesulfonohydrazide |
| SMILES | CCS(=O)(=O)NN(NS(=O)(=O)CC)c1cc(-c2ncc(C(F)(F)F)cc2Cl)ccc1C#N |
| InChI | InChI=1S/C17H17ClF3N5O4S2/c1-3-31(27,28)24-26(25-32(29,30)4-2)15-7-11(5-6-12(15)9-22)16-14(18)8-13(10-23-16)17(19,20)21/h5-8,10,24-25H,3-4H2,1-2H3 |
| InChIKey | JPPCPNDTSIZYFX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 132.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.94 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|