C11H12ClN4O3S+ — CID 166830127
methyl 2-[4-(5-chloropyrimidin-2-yl)pyridazin-1-ium-1-yl]ethanesulfonate (PubChem CID 166830127) has the molecular formula C11H12ClN4O3S+ and a molecular weight of 315.76 g/mol. Its IUPAC name is methyl 2-[4-(5-chloropyrimidin-2-yl)pyridazin-1-ium-1-yl]ethanesulfonate.
| Compound Name | methyl 2-[4-(5-chloropyrimidin-2-yl)pyridazin-1-ium-1-yl]ethanesulfonate |
|---|---|
| PubChem CID | 166830127 |
| Molecular Formula | C11H12ClN4O3S+ |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | methyl 2-[4-(5-chloropyrimidin-2-yl)pyridazin-1-ium-1-yl]ethanesulfonate |
| SMILES | COS(=O)(=O)CC[n+]1ccc(-c2ncc(Cl)cn2)cn1 |
| InChI | InChI=1S/C11H12ClN4O3S/c1-19-20(17,18)5-4-16-3-2-9(6-15-16)11-13-7-10(12)8-14-11/h2-3,6-8H,4-5H2,1H3/q+1 |
| InChIKey | MDNXSWFOMCSKEQ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 85.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|