C13H18N5O3S+ — CID 147125895
methyl 2-[4-[5-(dimethylamino)pyrimidin-2-yl]pyridazin-1-ium-1-yl]ethanesulfonate (PubChem CID 147125895) has the molecular formula C13H18N5O3S+ and a molecular weight of 324.39 g/mol. Its IUPAC name is methyl 2-[4-[5-(dimethylamino)pyrimidin-2-yl]pyridazin-1-ium-1-yl]ethanesulfonate.
| Compound Name | methyl 2-[4-[5-(dimethylamino)pyrimidin-2-yl]pyridazin-1-ium-1-yl]ethanesulfonate |
|---|---|
| PubChem CID | 147125895 |
| Molecular Formula | C13H18N5O3S+ |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | methyl 2-[4-[5-(dimethylamino)pyrimidin-2-yl]pyridazin-1-ium-1-yl]ethanesulfonate |
| SMILES | COS(=O)(=O)CC[n+]1ccc(-c2ncc(N(C)C)cn2)cn1 |
| InChI | InChI=1S/C13H18N5O3S/c1-17(2)12-9-14-13(15-10-12)11-4-5-18(16-8-11)6-7-22(19,20)21-3/h4-5,8-10H,6-7H2,1-3H3/q+1 |
| InChIKey | BPGOYSFVXTUKIW-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 89.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|