C14H10F6N4O4 — CID 159289886
2,2,2-trifluoroacetate;3-[4-[5-(trifluoromethyl)pyrimidin-2-yl]pyridazin-1-ium-1-yl]propanoic acid (PubChem CID 159289886) has the molecular formula C14H10F6N4O4 and a molecular weight of 412.25 g/mol. Its IUPAC name is 2,2,2-trifluoroacetate;3-[4-[5-(trifluoromethyl)pyrimidin-2-yl]pyridazin-1-ium-1-yl]propanoic acid.
| Compound Name | 2,2,2-trifluoroacetate;3-[4-[5-(trifluoromethyl)pyrimidin-2-yl]pyridazin-1-ium-1-yl]propanoic acid |
|---|---|
| PubChem CID | 159289886 |
| Molecular Formula | C14H10F6N4O4 |
| Molecular Weight | 412.25 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 2,2,2-trifluoroacetate;3-[4-[5-(trifluoromethyl)pyrimidin-2-yl]pyridazin-1-ium-1-yl]propanoic acid |
| SMILES | O=C(O)CC[n+]1ccc(-c2ncc(C(F)(F)F)cn2)cn1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C12H9F3N4O2.C2HF3O2/c13-12(14,15)9-6-16-11(17-7-9)8-1-3-19(18-5-8)4-2-10(20)21;3-2(4,5)1(6)7/h1,3,5-7H,2,4H2;(H,6,7) |
| InChIKey | QSXDDGYEQLFUCQ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 119.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.25 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|