C10H10N3O2S+ — CID 139555007
3-[4-(1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]propanoic acid (PubChem CID 139555007) has the molecular formula C10H10N3O2S+ and a molecular weight of 236.28 g/mol. Its IUPAC name is 3-[4-(1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]propanoic acid.
| Compound Name | 3-[4-(1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]propanoic acid |
|---|---|
| PubChem CID | 139555007 |
| Molecular Formula | C10H10N3O2S+ |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 3-[4-(1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]propanoic acid |
| SMILES | O=C(O)CC[n+]1ccc(-c2nccs2)cn1 |
| InChI | InChI=1S/C10H9N3O2S/c14-9(15)2-5-13-4-1-8(7-12-13)10-11-3-6-16-10/h1,3-4,6-7H,2,5H2/p+1 |
| InChIKey | CJHYAGOOAAOVDV-UHFFFAOYSA-O |
| XLogP | 0.97 |
| TPSA | 66.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|