C9H9N4O2S+ — CID 139554984
3-[4-(thiadiazol-5-yl)pyridazin-1-ium-1-yl]propanoic acid (PubChem CID 139554984) has the molecular formula C9H9N4O2S+ and a molecular weight of 237.26 g/mol. Its IUPAC name is 3-[4-(thiadiazol-5-yl)pyridazin-1-ium-1-yl]propanoic acid.
| Compound Name | 3-[4-(thiadiazol-5-yl)pyridazin-1-ium-1-yl]propanoic acid |
|---|---|
| PubChem CID | 139554984 |
| Molecular Formula | C9H9N4O2S+ |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 3-[4-(thiadiazol-5-yl)pyridazin-1-ium-1-yl]propanoic acid |
| SMILES | O=C(O)CC[n+]1ccc(-c2cnns2)cn1 |
| InChI | InChI=1S/C9H8N4O2S/c14-9(15)2-4-13-3-1-7(5-11-13)8-6-10-12-16-8/h1,3,5-6H,2,4H2/p+1 |
| InChIKey | PFZVNASFIRVHKH-UHFFFAOYSA-O |
| XLogP | 0.36 |
| TPSA | 79.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|