C15H11F6N3O4 — CID 161344634
2,2,2-trifluoroacetate;3-[4-[2-(trifluoromethyl)-4-pyridinyl]pyridazin-1-ium-1-yl]propanoic acid (PubChem CID 161344634) has the molecular formula C15H11F6N3O4 and a molecular weight of 411.26 g/mol. Its IUPAC name is 2,2,2-trifluoroacetate;3-[4-[2-(trifluoromethyl)-4-pyridinyl]pyridazin-1-ium-1-yl]propanoic acid.
| Compound Name | 2,2,2-trifluoroacetate;3-[4-[2-(trifluoromethyl)-4-pyridinyl]pyridazin-1-ium-1-yl]propanoic acid |
|---|---|
| PubChem CID | 161344634 |
| Molecular Formula | C15H11F6N3O4 |
| Molecular Weight | 411.26 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 2,2,2-trifluoroacetate;3-[4-[2-(trifluoromethyl)-4-pyridinyl]pyridazin-1-ium-1-yl]propanoic acid |
| SMILES | O=C(O)CC[n+]1ccc(-c2ccnc(C(F)(F)F)c2)cn1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C13H10F3N3O2.C2HF3O2/c14-13(15,16)11-7-9(1-4-17-11)10-2-5-19(18-8-10)6-3-12(20)21;3-2(4,5)1(6)7/h1-2,4-5,7-8H,3,6H2;(H,6,7) |
| InChIKey | FGVXHJKNJALCIW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|