C17H18F3N3O5S — CID 164961157
2,2-dimethyl-4-oxo-6-[4-(1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]hexanoic acid;2,2,2-trifluoroacetate (PubChem CID 164961157) has the molecular formula C17H18F3N3O5S and a molecular weight of 433.41 g/mol. Its IUPAC name is 2,2-dimethyl-4-oxo-6-[4-(1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]hexanoic acid;2,2,2-trifluoroacetate.
| Compound Name | 2,2-dimethyl-4-oxo-6-[4-(1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]hexanoic acid;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 164961157 |
| Molecular Formula | C17H18F3N3O5S |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 2,2-dimethyl-4-oxo-6-[4-(1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]hexanoic acid;2,2,2-trifluoroacetate |
| SMILES | CC(C)(CC(=O)CC[n+]1ccc(-c2nccs2)cn1)C(=O)O.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C15H17N3O3S.C2HF3O2/c1-15(2,14(20)21)9-12(19)4-7-18-6-3-11(10-17-18)13-16-5-8-22-13;3-2(4,5)1(6)7/h3,5-6,8,10H,4,7,9H2,1-2H3;(H,6,7) |
| InChIKey | XXIYBLOBQQEYMD-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 124.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|