C10H10N3O2S+ — CID 156626139
methyl 2-[4-(1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]acetate (PubChem CID 156626139) has the molecular formula C10H10N3O2S+ and a molecular weight of 236.28 g/mol. Its IUPAC name is methyl 2-[4-(1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]acetate.
| Compound Name | methyl 2-[4-(1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]acetate |
|---|---|
| PubChem CID | 156626139 |
| Molecular Formula | C10H10N3O2S+ |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | methyl 2-[4-(1,3-thiazol-2-yl)pyridazin-1-ium-1-yl]acetate |
| SMILES | COC(=O)C[n+]1ccc(-c2nccs2)cn1 |
| InChI | InChI=1S/C10H10N3O2S/c1-15-9(14)7-13-4-2-8(6-12-13)10-11-3-5-16-10/h2-6H,7H2,1H3/q+1 |
| InChIKey | JBTRDCSJRADRFE-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 55.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|