C16H12F3N5O4 — CID 154673322
3-[4-(1,2,4-benzotriazin-3-yl)pyridazin-1-ium-1-yl]propanoic acid;2,2,2-trifluoroacetate (PubChem CID 154673322) has the molecular formula C16H12F3N5O4 and a molecular weight of 395.30 g/mol. Its IUPAC name is 3-[4-(1,2,4-benzotriazin-3-yl)pyridazin-1-ium-1-yl]propanoic acid;2,2,2-trifluoroacetate.
| Compound Name | 3-[4-(1,2,4-benzotriazin-3-yl)pyridazin-1-ium-1-yl]propanoic acid;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 154673322 |
| Molecular Formula | C16H12F3N5O4 |
| Molecular Weight | 395.30 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 3-[4-(1,2,4-benzotriazin-3-yl)pyridazin-1-ium-1-yl]propanoic acid;2,2,2-trifluoroacetate |
| SMILES | O=C(O)CC[n+]1ccc(-c2nnc3ccccc3n2)cn1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C14H11N5O2.C2HF3O2/c20-13(21)6-8-19-7-5-10(9-15-19)14-16-11-3-1-2-4-12(11)17-18-14;3-2(4,5)1(6)7/h1-5,7,9H,6,8H2;(H,6,7) |
| InChIKey | ZSEIKBYUCWSXPH-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 132.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.30 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|