C14H13F3N4O4 — CID 162312789
methyl 3-(4-pyridazin-3-ylpyridazin-1-ium-1-yl)propanoate;2,2,2-trifluoroacetate (PubChem CID 162312789) has the molecular formula C14H13F3N4O4 and a molecular weight of 358.28 g/mol. Its IUPAC name is methyl 3-(4-pyridazin-3-ylpyridazin-1-ium-1-yl)propanoate;2,2,2-trifluoroacetate.
| Compound Name | methyl 3-(4-pyridazin-3-ylpyridazin-1-ium-1-yl)propanoate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 162312789 |
| Molecular Formula | C14H13F3N4O4 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | methyl 3-(4-pyridazin-3-ylpyridazin-1-ium-1-yl)propanoate;2,2,2-trifluoroacetate |
| SMILES | COC(=O)CC[n+]1ccc(-c2cccnn2)cn1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C12H13N4O2.C2HF3O2/c1-18-12(17)5-8-16-7-4-10(9-14-16)11-3-2-6-13-15-11;3-2(4,5)1(6)7/h2-4,6-7,9H,5,8H2,1H3;(H,6,7)/q+1;/p-1 |
| InChIKey | SQJFUTFRYOVIAG-UHFFFAOYSA-M |
| XLogP | -0.31 |
| TPSA | 108.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|