C14H14F3N4O5+ — CID 142529998
methyl 2,2,2-trifluoroacetate;3-[4-(6-oxo-1H-pyrimidin-2-yl)pyridazin-1-ium-1-yl]propanoic acid (PubChem CID 142529998) has the molecular formula C14H14F3N4O5+ and a molecular weight of 375.28 g/mol. Its IUPAC name is methyl 2,2,2-trifluoroacetate;3-[4-(6-oxo-1H-pyrimidin-2-yl)pyridazin-1-ium-1-yl]propanoic acid.
| Compound Name | methyl 2,2,2-trifluoroacetate;3-[4-(6-oxo-1H-pyrimidin-2-yl)pyridazin-1-ium-1-yl]propanoic acid |
|---|---|
| PubChem CID | 142529998 |
| Molecular Formula | C14H14F3N4O5+ |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | methyl 2,2,2-trifluoroacetate;3-[4-(6-oxo-1H-pyrimidin-2-yl)pyridazin-1-ium-1-yl]propanoic acid |
| SMILES | COC(=O)C(F)(F)F.O=C(O)CC[n+]1ccc(-c2nccc(=O)[nH]2)cn1 |
| InChI | InChI=1S/C11H10N4O3.C3H3F3O2/c16-9-1-4-12-11(14-9)8-2-5-15(13-7-8)6-3-10(17)18;1-8-2(7)3(4,5)6/h1-2,4-5,7H,3,6H2,(H-,12,14,16,17,18);1H3/p+1 |
| InChIKey | FLZVMKJHGQPBHE-UHFFFAOYSA-O |
| XLogP | 0.32 |
| TPSA | 126.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|