C12H15F3N3O5+ — CID 163979623
3-[4-(ethylcarbamoyl)pyridazin-1-ium-1-yl]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 163979623) has the molecular formula C12H15F3N3O5+ and a molecular weight of 338.26 g/mol. Its IUPAC name is 3-[4-(ethylcarbamoyl)pyridazin-1-ium-1-yl]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[4-(ethylcarbamoyl)pyridazin-1-ium-1-yl]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 163979623 |
| Molecular Formula | C12H15F3N3O5+ |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 3-[4-(ethylcarbamoyl)pyridazin-1-ium-1-yl]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCNC(=O)c1cc[n+](CCC(=O)O)nc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H13N3O3.C2HF3O2/c1-2-11-10(16)8-3-5-13(12-7-8)6-4-9(14)15;3-2(4,5)1(6)7/h3,5,7H,2,4,6H2,1H3,(H-,11,14,15,16);(H,6,7)/p+1 |
| InChIKey | SZUCACVOFXNGKI-UHFFFAOYSA-O |
| XLogP | 0.23 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|