C11H15F3N3O6P — CID 163568837
2-[4-(ethylcarbamoyl)pyridazin-1-ium-1-yl]ethylphosphonic acid;2,2,2-trifluoroacetate (PubChem CID 163568837) has the molecular formula C11H15F3N3O6P and a molecular weight of 373.22 g/mol. Its IUPAC name is 2-[4-(ethylcarbamoyl)pyridazin-1-ium-1-yl]ethylphosphonic acid;2,2,2-trifluoroacetate.
| Compound Name | 2-[4-(ethylcarbamoyl)pyridazin-1-ium-1-yl]ethylphosphonic acid;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 163568837 |
| Molecular Formula | C11H15F3N3O6P |
| Molecular Weight | 373.22 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 2-[4-(ethylcarbamoyl)pyridazin-1-ium-1-yl]ethylphosphonic acid;2,2,2-trifluoroacetate |
| SMILES | CCNC(=O)c1cc[n+](CCP(=O)(O)O)nc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C9H14N3O4P.C2HF3O2/c1-2-10-9(13)8-3-4-12(11-7-8)5-6-17(14,15)16;3-2(4,5)1(6)7/h3-4,7H,2,5-6H2,1H3,(H2-,10,13,14,15,16);(H,6,7) |
| InChIKey | ONZODAWKLWUNBT-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.22 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|