C12H18N3O3+ — CID 147982171
3-[4-(ethylcarbamoyl)pyridazin-1-ium-1-yl]-2,2-dimethylpropanoic acid (PubChem CID 147982171) has the molecular formula C12H18N3O3+ and a molecular weight of 252.29 g/mol. Its IUPAC name is 3-[4-(ethylcarbamoyl)pyridazin-1-ium-1-yl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[4-(ethylcarbamoyl)pyridazin-1-ium-1-yl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 147982171 |
| Molecular Formula | C12H18N3O3+ |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 3-[4-(ethylcarbamoyl)pyridazin-1-ium-1-yl]-2,2-dimethylpropanoic acid |
| SMILES | CCNC(=O)c1cc[n+](CC(C)(C)C(=O)O)nc1 |
| InChI | InChI=1S/C12H17N3O3/c1-4-13-10(16)9-5-6-15(14-7-9)8-12(2,3)11(17)18/h5-7H,4,8H2,1-3H3,(H-,13,16,17,18)/p+1 |
| InChIKey | DQHYDTCSSFIIKM-UHFFFAOYSA-O |
| XLogP | 0.23 |
| TPSA | 83.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|