C12H16N3O4+ — CID 146616223
3-[4-(3-oxobutylcarbamoyl)pyridazin-1-ium-1-yl]propanoic acid (PubChem CID 146616223) has the molecular formula C12H16N3O4+ and a molecular weight of 266.28 g/mol. Its IUPAC name is 3-[4-(3-oxobutylcarbamoyl)pyridazin-1-ium-1-yl]propanoic acid.
| Compound Name | 3-[4-(3-oxobutylcarbamoyl)pyridazin-1-ium-1-yl]propanoic acid |
|---|---|
| PubChem CID | 146616223 |
| Molecular Formula | C12H16N3O4+ |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 3-[4-(3-oxobutylcarbamoyl)pyridazin-1-ium-1-yl]propanoic acid |
| SMILES | CC(=O)CCNC(=O)c1cc[n+](CCC(=O)O)nc1 |
| InChI | InChI=1S/C12H15N3O4/c1-9(16)2-5-13-12(19)10-3-6-15(14-8-10)7-4-11(17)18/h3,6,8H,2,4-5,7H2,1H3,(H-,13,17,18,19)/p+1 |
| InChIKey | GKRTVNNJDBQTQA-UHFFFAOYSA-O |
| XLogP | -0.45 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|