C11H18F2N3O3+ — CID 154674138
fluoromethane;3-[(1-methylpyridazin-1-ium-4-carbonyl)amino]propanoic acid (PubChem CID 154674138) has the molecular formula C11H18F2N3O3+ and a molecular weight of 278.28 g/mol. Its IUPAC name is fluoromethane;3-[(1-methylpyridazin-1-ium-4-carbonyl)amino]propanoic acid.
| Compound Name | fluoromethane;3-[(1-methylpyridazin-1-ium-4-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 154674138 |
| Molecular Formula | C11H18F2N3O3+ |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | fluoromethane;3-[(1-methylpyridazin-1-ium-4-carbonyl)amino]propanoic acid |
| SMILES | CF.CF.C[n+]1ccc(C(=O)NCCC(=O)O)cn1 |
| InChI | InChI=1S/C9H11N3O3.2CH3F/c1-12-5-3-7(6-11-12)9(15)10-4-2-8(13)14;2*1-2/h3,5-6H,2,4H2,1H3,(H-,10,13,14,15);2*1H3/p+1 |
| InChIKey | RLQKLGBXFGUUFE-UHFFFAOYSA-O |
| XLogP | 0.28 |
| TPSA | 83.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|