C14H18N2O4 — CID 59125594
3-[[4-[3-(deuterioamino)-2-methyl-3-oxopropyl]benzoyl]amino]propanoic acid (PubChem CID 59125594) has the molecular formula C14H18N2O4 and a molecular weight of 279.31 g/mol. Its IUPAC name is 3-[[4-[3-(deuterioamino)-2-methyl-3-oxopropyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[3-(deuterioamino)-2-methyl-3-oxopropyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 59125594 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 3-[[4-[3-(deuterioamino)-2-methyl-3-oxopropyl]benzoyl]amino]propanoic acid |
| SMILES | [2H]NC(=O)C(C)Cc1ccc(C(=O)NCCC(=O)O)cc1 |
| InChI | InChI=1S/C14H18N2O4/c1-9(13(15)19)8-10-2-4-11(5-3-10)14(20)16-7-6-12(17)18/h2-5,9H,6-8H2,1H3,(H2,15,19)(H,16,20)(H,17,18)/i/hD |
| InChIKey | NTERQTXFBHHWTK-DYCDLGHISA-N |
| XLogP | 0.56 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |