C13H18N2O3 — CID 59032279
3-[[4-[[deuteriomethyl(methyl)amino]methyl]benzoyl]amino]propanoic acid (PubChem CID 59032279) has the molecular formula C13H18N2O3 and a molecular weight of 251.30 g/mol. Its IUPAC name is 3-[[4-[[deuteriomethyl(methyl)amino]methyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[[deuteriomethyl(methyl)amino]methyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 59032279 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 3-[[4-[[deuteriomethyl(methyl)amino]methyl]benzoyl]amino]propanoic acid |
| SMILES | [2H]CN(C)Cc1ccc(C(=O)NCCC(=O)O)cc1 |
| InChI | InChI=1S/C13H18N2O3/c1-15(2)9-10-3-5-11(6-4-10)13(18)14-8-7-12(16)17/h3-6H,7-9H2,1-2H3,(H,14,18)(H,16,17)/i1D |
| InChIKey | VOTHVKCOJDDCGT-MICDWDOJSA-N |
| XLogP | 0.95 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |