C25H28N2O4 — CID 67488997
3-[[4-[3-amino-2-[4-(cyclohexen-1-yl)phenyl]-3-oxopropyl]benzoyl]amino]propanoic acid (PubChem CID 67488997) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is 3-[[4-[3-amino-2-[4-(cyclohexen-1-yl)phenyl]-3-oxopropyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[3-amino-2-[4-(cyclohexen-1-yl)phenyl]-3-oxopropyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 67488997 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 3-[[4-[3-amino-2-[4-(cyclohexen-1-yl)phenyl]-3-oxopropyl]benzoyl]amino]propanoic acid |
| SMILES | NC(=O)C(Cc1ccc(C(=O)NCCC(=O)O)cc1)c1ccc(C2=CCCCC2)cc1 |
| InChI | InChI=1S/C25H28N2O4/c26-24(30)22(20-12-10-19(11-13-20)18-4-2-1-3-5-18)16-17-6-8-21(9-7-17)25(31)27-15-14-23(28)29/h4,6-13,22H,1-3,5,14-16H2,(H2,26,30)(H,27,31)(H,28,29) |
| InChIKey | FONSTDLRILSXHG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |