C31H32N2O4S — CID 67765482
3-[[4-[2-[4-(cyclohexen-1-yl)phenyl]-3-oxo-3-(3-sulfanylanilino)propyl]benzoyl]amino]propanoic acid (PubChem CID 67765482) has the molecular formula C31H32N2O4S and a molecular weight of 528.67 g/mol. Its IUPAC name is 3-[[4-[2-[4-(cyclohexen-1-yl)phenyl]-3-oxo-3-(3-sulfanylanilino)propyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[2-[4-(cyclohexen-1-yl)phenyl]-3-oxo-3-(3-sulfanylanilino)propyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 67765482 |
| Molecular Formula | C31H32N2O4S |
| Molecular Weight | 528.67 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | 3-[[4-[2-[4-(cyclohexen-1-yl)phenyl]-3-oxo-3-(3-sulfanylanilino)propyl]benzoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1ccc(CC(C(=O)Nc2cccc(S)c2)c2ccc(C3=CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C31H32N2O4S/c34-29(35)17-18-32-30(36)25-11-9-21(10-12-25)19-28(31(37)33-26-7-4-8-27(38)20-26)24-15-13-23(14-16-24)22-5-2-1-3-6-22/h4-5,7-16,20,28,38H,1-3,6,17-19H2,(H,32,36)(H,33,37)(H,34,35) |
| InChIKey | KOPXMFYNHYBWIY-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.67 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|