C16H15N4O3+ — CID 162507773
3-[4-[(4-cyanophenyl)methylcarbamoyl]pyridazin-1-ium-1-yl]propanoic acid (PubChem CID 162507773) has the molecular formula C16H15N4O3+ and a molecular weight of 311.32 g/mol. Its IUPAC name is 3-[4-[(4-cyanophenyl)methylcarbamoyl]pyridazin-1-ium-1-yl]propanoic acid.
| Compound Name | 3-[4-[(4-cyanophenyl)methylcarbamoyl]pyridazin-1-ium-1-yl]propanoic acid |
|---|---|
| PubChem CID | 162507773 |
| Molecular Formula | C16H15N4O3+ |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 3-[4-[(4-cyanophenyl)methylcarbamoyl]pyridazin-1-ium-1-yl]propanoic acid |
| SMILES | N#Cc1ccc(CNC(=O)c2cc[n+](CCC(=O)O)nc2)cc1 |
| InChI | InChI=1S/C16H14N4O3/c17-9-12-1-3-13(4-2-12)10-18-16(23)14-5-7-20(19-11-14)8-6-15(21)22/h1-5,7,11H,6,8,10H2,(H-,18,21,22,23)/p+1 |
| InChIKey | ABKSKTSSDSDEIL-UHFFFAOYSA-O |
| XLogP | 0.65 |
| TPSA | 106.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|