C10H14F3N4O3S+ — CID 146616537
N-ethyl-1-[2-(trifluoromethylsulfonylamino)ethyl]pyridazin-1-ium-4-carboxamide (PubChem CID 146616537) has the molecular formula C10H14F3N4O3S+ and a molecular weight of 327.31 g/mol. Its IUPAC name is N-ethyl-1-[2-(trifluoromethylsulfonylamino)ethyl]pyridazin-1-ium-4-carboxamide.
| Compound Name | N-ethyl-1-[2-(trifluoromethylsulfonylamino)ethyl]pyridazin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 146616537 |
| Molecular Formula | C10H14F3N4O3S+ |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | N-ethyl-1-[2-(trifluoromethylsulfonylamino)ethyl]pyridazin-1-ium-4-carboxamide |
| SMILES | CCNC(=O)c1cc[n+](CCNS(=O)(=O)C(F)(F)F)nc1 |
| InChI | InChI=1S/C10H13F3N4O3S/c1-2-14-9(18)8-3-5-17(15-7-8)6-4-16-21(19,20)10(11,12)13/h3,5,7,16H,2,4,6H2,1H3/p+1 |
| InChIKey | WSQYQYWUGUCGEM-UHFFFAOYSA-O |
| XLogP | -0.44 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|