C10H13N3O4S — CID 146615990
2-[4-(cyclopropylcarbamoyl)pyridazin-1-ium-1-yl]ethanesulfonate (PubChem CID 146615990) has the molecular formula C10H13N3O4S and a molecular weight of 271.30 g/mol. Its IUPAC name is 2-[4-(cyclopropylcarbamoyl)pyridazin-1-ium-1-yl]ethanesulfonate.
| Compound Name | 2-[4-(cyclopropylcarbamoyl)pyridazin-1-ium-1-yl]ethanesulfonate |
|---|---|
| PubChem CID | 146615990 |
| Molecular Formula | C10H13N3O4S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 2-[4-(cyclopropylcarbamoyl)pyridazin-1-ium-1-yl]ethanesulfonate |
| SMILES | O=C(NC1CC1)c1cc[n+](CCS(=O)(=O)[O-])nc1 |
| InChI | InChI=1S/C10H13N3O4S/c14-10(12-9-1-2-9)8-3-4-13(11-7-8)5-6-18(15,16)17/h3-4,7,9H,1-2,5-6H2,(H-,12,14,15,16,17) |
| InChIKey | JOFBCFPTKNYEPQ-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|