C10H15N4O3+ — CID 146572031
2-amino-3-[4-(ethylcarbamoyl)pyridazin-1-ium-1-yl]propanoic acid (PubChem CID 146572031) has the molecular formula C10H15N4O3+ and a molecular weight of 239.26 g/mol. Its IUPAC name is 2-amino-3-[4-(ethylcarbamoyl)pyridazin-1-ium-1-yl]propanoic acid.
| Compound Name | 2-amino-3-[4-(ethylcarbamoyl)pyridazin-1-ium-1-yl]propanoic acid |
|---|---|
| PubChem CID | 146572031 |
| Molecular Formula | C10H15N4O3+ |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 2-amino-3-[4-(ethylcarbamoyl)pyridazin-1-ium-1-yl]propanoic acid |
| SMILES | CCNC(=O)c1cc[n+](CC(N)C(=O)O)nc1 |
| InChI | InChI=1S/C10H14N4O3/c1-2-12-9(15)7-3-4-14(13-5-7)6-8(11)10(16)17/h3-5,8H,2,6,11H2,1H3,(H-,12,15,16,17)/p+1 |
| InChIKey | NFMQCAPNDXPXTG-UHFFFAOYSA-O |
| XLogP | -1.47 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|