C16H21F3N4O7 — CID 163685190
3-[4-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]carbamoyl]pyridazin-1-ium-1-yl]propanoic acid;2,2,2-trifluoroacetate (PubChem CID 163685190) has the molecular formula C16H21F3N4O7 and a molecular weight of 438.36 g/mol. Its IUPAC name is 3-[4-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]carbamoyl]pyridazin-1-ium-1-yl]propanoic acid;2,2,2-trifluoroacetate.
| Compound Name | 3-[4-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]carbamoyl]pyridazin-1-ium-1-yl]propanoic acid;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 163685190 |
| Molecular Formula | C16H21F3N4O7 |
| Molecular Weight | 438.36 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 3-[4-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]carbamoyl]pyridazin-1-ium-1-yl]propanoic acid;2,2,2-trifluoroacetate |
| SMILES | CN(NC(=O)c1cc[n+](CCC(=O)O)nc1)C(=O)OC(C)(C)C.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C14H20N4O5.C2HF3O2/c1-14(2,3)23-13(22)17(4)16-12(21)10-5-7-18(15-9-10)8-6-11(19)20;3-2(4,5)1(6)7/h5,7,9H,6,8H2,1-4H3,(H-,15,16,19,20,21);(H,6,7) |
| InChIKey | SSIDBIRIUMLCSS-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 152.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.36 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|