C12H15N4O4S+ — CID 166830123
methyl 3-(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)propyl sulfate (PubChem CID 166830123) has the molecular formula C12H15N4O4S+ and a molecular weight of 311.34 g/mol. Its IUPAC name is methyl 3-(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)propyl sulfate.
| Compound Name | methyl 3-(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)propyl sulfate |
|---|---|
| PubChem CID | 166830123 |
| Molecular Formula | C12H15N4O4S+ |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | methyl 3-(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)propyl sulfate |
| SMILES | COS(=O)(=O)OCCC[n+]1ccc(-c2ncccn2)cn1 |
| InChI | InChI=1S/C12H15N4O4S/c1-19-21(17,18)20-9-3-7-16-8-4-11(10-15-16)12-13-5-2-6-14-12/h2,4-6,8,10H,3,7,9H2,1H3/q+1 |
| InChIKey | NKXPCCYRCOSGLD-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 95.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|