C14H18N5O3S+ — CID 166830080
methyl 2-[(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)methyl]pyrrolidine-1-sulfonate (PubChem CID 166830080) has the molecular formula C14H18N5O3S+ and a molecular weight of 336.40 g/mol. Its IUPAC name is methyl 2-[(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)methyl]pyrrolidine-1-sulfonate.
| Compound Name | methyl 2-[(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)methyl]pyrrolidine-1-sulfonate |
|---|---|
| PubChem CID | 166830080 |
| Molecular Formula | C14H18N5O3S+ |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | methyl 2-[(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)methyl]pyrrolidine-1-sulfonate |
| SMILES | COS(=O)(=O)N1CCCC1C[n+]1ccc(-c2ncccn2)cn1 |
| InChI | InChI=1S/C14H18N5O3S/c1-22-23(20,21)19-8-2-4-13(19)11-18-9-5-12(10-17-18)14-15-6-3-7-16-14/h3,5-7,9-10,13H,2,4,8,11H2,1H3/q+1 |
| InChIKey | ALVSAKWHWSLWHN-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 89.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|