C18H20N6O3S — CID 46956638
2-[2-[[(2S)-1-(4-methoxyphenyl)sulfonylpyrrolidin-2-yl]methyl]tetrazol-5-yl]pyridine (PubChem CID 46956638) has the molecular formula C18H20N6O3S and a molecular weight of 400.46 g/mol. Its IUPAC name is 2-[2-[[(2S)-1-(4-methoxyphenyl)sulfonylpyrrolidin-2-yl]methyl]tetrazol-5-yl]pyridine.
| Compound Name | 2-[2-[[(2S)-1-(4-methoxyphenyl)sulfonylpyrrolidin-2-yl]methyl]tetrazol-5-yl]pyridine |
|---|---|
| PubChem CID | 46956638 |
| Molecular Formula | C18H20N6O3S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 2-[2-[[(2S)-1-(4-methoxyphenyl)sulfonylpyrrolidin-2-yl]methyl]tetrazol-5-yl]pyridine |
| SMILES | COc1ccc(S(=O)(=O)N2CCC[C@H]2Cn2nnc(-c3ccccn3)n2)cc1 |
| InChI | InChI=1S/C18H20N6O3S/c1-27-15-7-9-16(10-8-15)28(25,26)23-12-4-5-14(23)13-24-21-18(20-22-24)17-6-2-3-11-19-17/h2-3,6-11,14H,4-5,12-13H2,1H3/t14-/m0/s1 |
| InChIKey | GSVBGWAMUNCYID-AWEZNQCLSA-N |
| XLogP | 1.60 |
| TPSA | 103.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |