C15H19ClN4O2S — CID 120711693
[1-(2-phenylpyrimidin-5-yl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride (PubChem CID 120711693) has the molecular formula C15H19ClN4O2S and a molecular weight of 354.86 g/mol. Its IUPAC name is [1-(2-phenylpyrimidin-5-yl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride.
| Compound Name | [1-(2-phenylpyrimidin-5-yl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120711693 |
| Molecular Formula | C15H19ClN4O2S |
| Molecular Weight | 354.86 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | [1-(2-phenylpyrimidin-5-yl)sulfonylpyrrolidin-2-yl]methanamine;hydrochloride |
| SMILES | Cl.NCC1CCCN1S(=O)(=O)c1cnc(-c2ccccc2)nc1 |
| InChI | InChI=1S/C15H18N4O2S.ClH/c16-9-13-7-4-8-19(13)22(20,21)14-10-17-15(18-11-14)12-5-2-1-3-6-12;/h1-3,5-6,10-11,13H,4,7-9,16H2;1H |
| InChIKey | WMYUZMIKOBANPM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.86 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |