C17H17ClN3O4- — CID 135846234
4-chloro-3-[(2E)-2-[(4-ethoxycarbonyl-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]hydrazinyl]benzoate (PubChem CID 135846234) has the molecular formula C17H17ClN3O4- and a molecular weight of 362.79 g/mol. Its IUPAC name is 4-chloro-3-[(2E)-2-[(4-ethoxycarbonyl-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]hydrazinyl]benzoate.
| Compound Name | 4-chloro-3-[(2E)-2-[(4-ethoxycarbonyl-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 135846234 |
| Molecular Formula | C17H17ClN3O4- |
| Molecular Weight | 362.79 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 4-chloro-3-[(2E)-2-[(4-ethoxycarbonyl-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]hydrazinyl]benzoate |
| SMILES | CCOC(=O)c1c(C)[nH]c(/C=N/Nc2cc(C(=O)[O-])ccc2Cl)c1C |
| InChI | InChI=1S/C17H18ClN3O4/c1-4-25-17(24)15-9(2)14(20-10(15)3)8-19-21-13-7-11(16(22)23)5-6-12(13)18/h5-8,20-21H,4H2,1-3H3,(H,22,23)/p-1/b19-8+ |
| InChIKey | KZPYWIIHYSYUQD-UFWORHAWSA-M |
| XLogP | 2.27 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.79 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|