C13H8ClF3N2 — CID 145433145
N-(2,4-difluorophenyl)-4-fluorobenzenecarbohydrazonoyl chloride (PubChem CID 145433145) has the molecular formula C13H8ClF3N2 and a molecular weight of 284.67 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-4-fluorobenzenecarbohydrazonoyl chloride.
| Compound Name | N-(2,4-difluorophenyl)-4-fluorobenzenecarbohydrazonoyl chloride |
|---|---|
| PubChem CID | 145433145 |
| Molecular Formula | C13H8ClF3N2 |
| Molecular Weight | 284.67 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | N-(2,4-difluorophenyl)-4-fluorobenzenecarbohydrazonoyl chloride |
| SMILES | Fc1ccc(C(Cl)=NNc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C13H8ClF3N2/c14-13(8-1-3-9(15)4-2-8)19-18-12-6-5-10(16)7-11(12)17/h1-7,18H |
| InChIKey | KODURZSVHHXIAR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.67 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|