C15H10F3NO — CID 18527574
(Z)-3-(2,4-difluoroanilino)-1-(4-fluorophenyl)prop-2-en-1-one (PubChem CID 18527574) has the molecular formula C15H10F3NO and a molecular weight of 277.25 g/mol. Its IUPAC name is (Z)-3-(2,4-difluoroanilino)-1-(4-fluorophenyl)prop-2-en-1-one.
| Compound Name | (Z)-3-(2,4-difluoroanilino)-1-(4-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 18527574 |
| Molecular Formula | C15H10F3NO |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | (Z)-3-(2,4-difluoroanilino)-1-(4-fluorophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C\Nc1ccc(F)cc1F)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H10F3NO/c16-11-3-1-10(2-4-11)15(20)7-8-19-14-6-5-12(17)9-13(14)18/h1-9,19H/b8-7- |
| InChIKey | LKQFJICYGLHEBY-FPLPWBNLSA-N |
| XLogP | 3.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|