C17H16FNO — CID 19581250
(E)-3-(2,3-dimethylanilino)-1-(4-fluorophenyl)prop-2-en-1-one (PubChem CID 19581250) has the molecular formula C17H16FNO and a molecular weight of 269.32 g/mol. Its IUPAC name is (E)-3-(2,3-dimethylanilino)-1-(4-fluorophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(2,3-dimethylanilino)-1-(4-fluorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19581250 |
| Molecular Formula | C17H16FNO |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | (E)-3-(2,3-dimethylanilino)-1-(4-fluorophenyl)prop-2-en-1-one |
| SMILES | Cc1cccc(N/C=C/C(=O)c2ccc(F)cc2)c1C |
| InChI | InChI=1S/C17H16FNO/c1-12-4-3-5-16(13(12)2)19-11-10-17(20)14-6-8-15(18)9-7-14/h3-11,19H,1-2H3/b11-10+ |
| InChIKey | FOXDWLAEBUNWQJ-ZHACJKMWSA-N |
| XLogP | 4.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|