C20H23NO — CID 46858478
(E)-3-(2,3-dimethylanilino)-1-(4-propan-2-ylphenyl)prop-2-en-1-one (PubChem CID 46858478) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is (E)-3-(2,3-dimethylanilino)-1-(4-propan-2-ylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(2,3-dimethylanilino)-1-(4-propan-2-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 46858478 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (E)-3-(2,3-dimethylanilino)-1-(4-propan-2-ylphenyl)prop-2-en-1-one |
| SMILES | Cc1cccc(N/C=C/C(=O)c2ccc(C(C)C)cc2)c1C |
| InChI | InChI=1S/C20H23NO/c1-14(2)17-8-10-18(11-9-17)20(22)12-13-21-19-7-5-6-15(3)16(19)4/h5-14,21H,1-4H3/b13-12+ |
| InChIKey | GRIDCLLDEQUMMM-OUKQBFOZSA-N |
| XLogP | 5.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|