C14H12F2N4 — CID 1471005
2-[3-(2,4-difluoroanilino)-1-(dimethylamino)prop-2-enylidene]propanedinitrile (PubChem CID 1471005) has the molecular formula C14H12F2N4 and a molecular weight of 274.27 g/mol. Its IUPAC name is 2-[3-(2,4-difluoroanilino)-1-(dimethylamino)prop-2-enylidene]propanedinitrile.
| Compound Name | 2-[3-(2,4-difluoroanilino)-1-(dimethylamino)prop-2-enylidene]propanedinitrile |
|---|---|
| PubChem CID | 1471005 |
| Molecular Formula | C14H12F2N4 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 2-[3-(2,4-difluoroanilino)-1-(dimethylamino)prop-2-enylidene]propanedinitrile |
| SMILES | CN(C)C(C=CNc1ccc(F)cc1F)=C(C#N)C#N |
| InChI | InChI=1S/C14H12F2N4/c1-20(2)14(10(8-17)9-18)5-6-19-13-4-3-11(15)7-12(13)16/h3-7,19H,1-2H3 |
| InChIKey | IAIMVYIWXWGOKK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 62.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|