C19H13F2NO — CID 126187125
(E)-3-(2,4-difluoroanilino)-1-naphthalen-1-ylprop-2-en-1-one (PubChem CID 126187125) has the molecular formula C19H13F2NO and a molecular weight of 309.32 g/mol. Its IUPAC name is (E)-3-(2,4-difluoroanilino)-1-naphthalen-1-ylprop-2-en-1-one.
| Compound Name | (E)-3-(2,4-difluoroanilino)-1-naphthalen-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 126187125 |
| Molecular Formula | C19H13F2NO |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (E)-3-(2,4-difluoroanilino)-1-naphthalen-1-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/Nc1ccc(F)cc1F)c1cccc2ccccc12 |
| InChI | InChI=1S/C19H13F2NO/c20-14-8-9-18(17(21)12-14)22-11-10-19(23)16-7-3-5-13-4-1-2-6-15(13)16/h1-12,22H/b11-10+ |
| InChIKey | SSPHWNWBZINMSJ-ZHACJKMWSA-N |
| XLogP | 4.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|