C16H21F2NO3 — CID 156738753
2,5-difluoro-N-methylaniline;ethyl (Z)-2-formylhex-2-enoate (PubChem CID 156738753) has the molecular formula C16H21F2NO3 and a molecular weight of 313.34 g/mol. Its IUPAC name is 2,5-difluoro-N-methylaniline;ethyl (Z)-2-formylhex-2-enoate.
| Compound Name | 2,5-difluoro-N-methylaniline;ethyl (Z)-2-formylhex-2-enoate |
|---|---|
| PubChem CID | 156738753 |
| Molecular Formula | C16H21F2NO3 |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 2,5-difluoro-N-methylaniline;ethyl (Z)-2-formylhex-2-enoate |
| SMILES | CCC/C=C(/C=O)C(=O)OCC.CNc1cc(F)ccc1F |
| InChI | InChI=1S/C9H14O3.C7H7F2N/c1-3-5-6-8(7-10)9(11)12-4-2;1-10-7-4-5(8)2-3-6(7)9/h6-7H,3-5H2,1-2H3;2-4,10H,1H3/b8-6-; |
| InChIKey | AXLZKNIWWBJXRW-PHZXCRFESA-N |
| XLogP | 3.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|